C18H24N4O7 — CID 18490001
2-[[2-[[2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]acetyl]amino]pentanedioic acid (PubChem CID 18490001) has the molecular formula C18H24N4O7 and a molecular weight of 408.41 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]acetyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]acetyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18490001 |
| Molecular Formula | C18H24N4O7 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 2-[[2-[[2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]acetyl]amino]pentanedioic acid |
| SMILES | NCC(=O)NC(Cc1ccccc1)C(=O)NCC(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H24N4O7/c19-9-14(23)22-13(8-11-4-2-1-3-5-11)17(27)20-10-15(24)21-12(18(28)29)6-7-16(25)26/h1-5,12-13H,6-10,19H2,(H,20,27)(H,21,24)(H,22,23)(H,25,26)(H,28,29) |
| InChIKey | QCAOYJZCXNVXEJ-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 187.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |