C29H35N5O10 — CID 10304407
(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-4-carboxybutanoyl]amino]butanedioic acid (PubChem CID 10304407) has the molecular formula C29H35N5O10 and a molecular weight of 613.62 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-4-carboxybutanoyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-4-carboxybutanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 10304407 |
| Molecular Formula | C29H35N5O10 |
| Molecular Weight | 613.62 g/mol |
| Exact Mass | 613.24 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-4-carboxybutanoyl]amino]butanedioic acid |
| SMILES | NCC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C29H35N5O10/c30-16-23(35)31-20(13-17-7-3-1-4-8-17)27(41)33-21(14-18-9-5-2-6-10-18)28(42)32-19(11-12-24(36)37)26(40)34-22(29(43)44)15-25(38)39/h1-10,19-22H,11-16,30H2,(H,31,35)(H,32,42)(H,33,41)(H,34,40)(H,36,37)(H,38,39)(H,43,44)/t19-,20-,21-,22-/m0/s1 |
| InChIKey | GQLGPJDSUYMPJQ-CMOCDZPBSA-N |
| XLogP | -1.21 |
| TPSA | 254.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.62 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |