C15H20N4O5 — CID 18221103
4-amino-2-[[2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]-4-oxobutanoic acid (PubChem CID 18221103) has the molecular formula C15H20N4O5 and a molecular weight of 336.35 g/mol. Its IUPAC name is 4-amino-2-[[2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18221103 |
| Molecular Formula | C15H20N4O5 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 4-amino-2-[[2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]-4-oxobutanoic acid |
| SMILES | NCC(=O)NC(Cc1ccccc1)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C15H20N4O5/c16-8-13(21)18-10(6-9-4-2-1-3-5-9)14(22)19-11(15(23)24)7-12(17)20/h1-5,10-11H,6-8,16H2,(H2,17,20)(H,18,21)(H,19,22)(H,23,24) |
| InChIKey | MTBIKIMYHUWBRX-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 164.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |