C23H28N4O5S — CID 18490116
2-[[2-[[2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18490116) has the molecular formula C23H28N4O5S and a molecular weight of 472.57 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[[2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18490116 |
| Molecular Formula | C23H28N4O5S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 2-[[2-[[2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | NCC(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C23H28N4O5S/c24-13-20(28)25-17(11-15-7-3-1-4-8-15)21(29)26-18(12-16-9-5-2-6-10-16)22(30)27-19(14-33)23(31)32/h1-10,17-19,33H,11-14,24H2,(H,25,28)(H,26,29)(H,27,30)(H,31,32) |
| InChIKey | FFCOXHRSHJPBFB-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|