C17H23N3O6 — CID 23278167
ethyl 2-[[2-[2-(phenylmethoxycarbonylamino)propanoylamino]acetyl]amino]acetate (PubChem CID 23278167) has the molecular formula C17H23N3O6 and a molecular weight of 365.39 g/mol. Its IUPAC name is ethyl 2-[[2-[2-(phenylmethoxycarbonylamino)propanoylamino]acetyl]amino]acetate.
| Compound Name | ethyl 2-[[2-[2-(phenylmethoxycarbonylamino)propanoylamino]acetyl]amino]acetate |
|---|---|
| PubChem CID | 23278167 |
| Molecular Formula | C17H23N3O6 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | ethyl 2-[[2-[2-(phenylmethoxycarbonylamino)propanoylamino]acetyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)CNC(=O)C(C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H23N3O6/c1-3-25-15(22)10-18-14(21)9-19-16(23)12(2)20-17(24)26-11-13-7-5-4-6-8-13/h4-8,12H,3,9-11H2,1-2H3,(H,18,21)(H,19,23)(H,20,24) |
| InChIKey | KWDMCDHDYAQNAW-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |