C19H26N2O7 — CID 102461717
ethyl (4S)-5-[(2-ethoxy-2-oxoethyl)amino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 102461717) has the molecular formula C19H26N2O7 and a molecular weight of 394.42 g/mol. Its IUPAC name is ethyl (4S)-5-[(2-ethoxy-2-oxoethyl)amino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | ethyl (4S)-5-[(2-ethoxy-2-oxoethyl)amino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 102461717 |
| Molecular Formula | C19H26N2O7 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | ethyl (4S)-5-[(2-ethoxy-2-oxoethyl)amino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | CCOC(=O)CC[C@H](NC(=O)OCc1ccccc1)C(=O)NCC(=O)OCC |
| InChI | InChI=1S/C19H26N2O7/c1-3-26-16(22)11-10-15(18(24)20-12-17(23)27-4-2)21-19(25)28-13-14-8-6-5-7-9-14/h5-9,15H,3-4,10-13H2,1-2H3,(H,20,24)(H,21,25)/t15-/m0/s1 |
| InChIKey | LGHFPCRELJGNPE-HNNXBMFYSA-N |
| XLogP | 1.30 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|