C18H26N4O6 — CID 10992887
ethyl 2-[2-[(2S)-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]hydrazinyl]acetate (PubChem CID 10992887) has the molecular formula C18H26N4O6 and a molecular weight of 394.43 g/mol. Its IUPAC name is ethyl 2-[2-[(2S)-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]hydrazinyl]acetate.
| Compound Name | ethyl 2-[2-[(2S)-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]hydrazinyl]acetate |
|---|---|
| PubChem CID | 10992887 |
| Molecular Formula | C18H26N4O6 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | ethyl 2-[2-[(2S)-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]hydrazinyl]acetate |
| SMILES | CCOC(=O)CNNC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H26N4O6/c1-4-27-15(23)10-19-22-17(25)13(3)20-16(24)12(2)21-18(26)28-11-14-8-6-5-7-9-14/h5-9,12-13,19H,4,10-11H2,1-3H3,(H,20,24)(H,21,26)(H,22,25)/t12-,13-/m0/s1 |
| InChIKey | UPKWSQJETGNNSA-STQMWFEESA-N |
| XLogP | -0.01 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|