C16H22N2O5 — CID 45049910
methyl (2S)-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]butanoate (PubChem CID 45049910) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]butanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]butanoate |
|---|---|
| PubChem CID | 45049910 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]butanoate |
| SMILES | CC[C@H](NC(=O)[C@H](C)NC(=O)OCc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C16H22N2O5/c1-4-13(15(20)22-3)18-14(19)11(2)17-16(21)23-10-12-8-6-5-7-9-12/h5-9,11,13H,4,10H2,1-3H3,(H,17,21)(H,18,19)/t11-,13-/m0/s1 |
| InChIKey | USPDOKIGYQPPGF-AAEUAGOBSA-N |
| XLogP | 1.37 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |