C16H19ClN2O7 — CID 165342342
methyl (2S)-3-carbonochloridoyloxy-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoate (PubChem CID 165342342) has the molecular formula C16H19ClN2O7 and a molecular weight of 386.79 g/mol. Its IUPAC name is methyl (2S)-3-carbonochloridoyloxy-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoate.
| Compound Name | methyl (2S)-3-carbonochloridoyloxy-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 165342342 |
| Molecular Formula | C16H19ClN2O7 |
| Molecular Weight | 386.79 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | methyl (2S)-3-carbonochloridoyloxy-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoate |
| SMILES | COC(=O)[C@H](COC(=O)Cl)NC(=O)[C@H](C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H19ClN2O7/c1-10(18-16(23)26-8-11-6-4-3-5-7-11)13(20)19-12(14(21)24-2)9-25-15(17)22/h3-7,10,12H,8-9H2,1-2H3,(H,18,23)(H,19,20)/t10-,12-/m0/s1 |
| InChIKey | PJJLVMQUHJIKGT-JQWIXIFHSA-N |
| XLogP | 1.33 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.79 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|