C19H24ClN3O7 — CID 16760474
5-chloro-4-oxo-2-[2-[2-(phenylmethoxycarbonylamino)propanoylamino]propanoylamino]pentanoic acid (PubChem CID 16760474) has the molecular formula C19H24ClN3O7 and a molecular weight of 441.87 g/mol. Its IUPAC name is 5-chloro-4-oxo-2-[2-[2-(phenylmethoxycarbonylamino)propanoylamino]propanoylamino]pentanoic acid.
| Compound Name | 5-chloro-4-oxo-2-[2-[2-(phenylmethoxycarbonylamino)propanoylamino]propanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 16760474 |
| Molecular Formula | C19H24ClN3O7 |
| Molecular Weight | 441.87 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 5-chloro-4-oxo-2-[2-[2-(phenylmethoxycarbonylamino)propanoylamino]propanoylamino]pentanoic acid |
| SMILES | CC(NC(=O)OCc1ccccc1)C(=O)NC(C)C(=O)NC(CC(=O)CCl)C(=O)O |
| InChI | InChI=1S/C19H24ClN3O7/c1-11(17(26)23-15(18(27)28)8-14(24)9-20)21-16(25)12(2)22-19(29)30-10-13-6-4-3-5-7-13/h3-7,11-12,15H,8-10H2,1-2H3,(H,21,25)(H,22,29)(H,23,26)(H,27,28) |
| InChIKey | TVCSFHHGURUEKZ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 150.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.87 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|