C14H17Cl2NO5 — CID 20833192
1,3-dichloropropan-2-one;2-(phenylmethoxycarbonylamino)propanoic acid (PubChem CID 20833192) has the molecular formula C14H17Cl2NO5 and a molecular weight of 350.20 g/mol. Its IUPAC name is 1,3-dichloropropan-2-one;2-(phenylmethoxycarbonylamino)propanoic acid.
| Compound Name | 1,3-dichloropropan-2-one;2-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 20833192 |
| Molecular Formula | C14H17Cl2NO5 |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 1,3-dichloropropan-2-one;2-(phenylmethoxycarbonylamino)propanoic acid |
| SMILES | CC(NC(=O)OCc1ccccc1)C(=O)O.O=C(CCl)CCl |
| InChI | InChI=1S/C11H13NO4.C3H4Cl2O/c1-8(10(13)14)12-11(15)16-7-9-5-3-2-4-6-9;4-1-3(6)2-5/h2-6,8H,7H2,1H3,(H,12,15)(H,13,14);1-2H2 |
| InChIKey | VSGFWDQDXYUVHA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|