C17H22Cl2N2O6 — CID 170987626
1,3-dichloropropan-2-one;(2S)-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid (PubChem CID 170987626) has the molecular formula C17H22Cl2N2O6 and a molecular weight of 421.28 g/mol. Its IUPAC name is 1,3-dichloropropan-2-one;(2S)-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid.
| Compound Name | 1,3-dichloropropan-2-one;(2S)-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 170987626 |
| Molecular Formula | C17H22Cl2N2O6 |
| Molecular Weight | 421.28 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 1,3-dichloropropan-2-one;(2S)-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid |
| SMILES | C[C@H](NC(=O)[C@H](C)NC(=O)OCc1ccccc1)C(=O)O.O=C(CCl)CCl |
| InChI | InChI=1S/C14H18N2O5.C3H4Cl2O/c1-9(12(17)15-10(2)13(18)19)16-14(20)21-8-11-6-4-3-5-7-11;4-1-3(6)2-5/h3-7,9-10H,8H2,1-2H3,(H,15,17)(H,16,20)(H,18,19);1-2H2/t9-,10-;/m0./s1 |
| InChIKey | HJJKUVRJOSEIIE-IYPAPVHQSA-N |
| XLogP | 1.92 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|