C13H16ClNO5 — CID 71437616
acetyl chloride;2-(phenylmethoxycarbonylamino)propanoic acid (PubChem CID 71437616) has the molecular formula C13H16ClNO5 and a molecular weight of 301.73 g/mol. Its IUPAC name is acetyl chloride;2-(phenylmethoxycarbonylamino)propanoic acid.
| Compound Name | acetyl chloride;2-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 71437616 |
| Molecular Formula | C13H16ClNO5 |
| Molecular Weight | 301.73 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | acetyl chloride;2-(phenylmethoxycarbonylamino)propanoic acid |
| SMILES | CC(=O)Cl.CC(NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C11H13NO4.C2H3ClO/c1-8(10(13)14)12-11(15)16-7-9-5-3-2-4-6-9;1-2(3)4/h2-6,8H,7H2,1H3,(H,12,15)(H,13,14);1H3 |
| InChIKey | UQNFQHKQLQNXOO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.73 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|