C13H17ClN2O3 — CID 125470316
benzyl N-[(2R)-1-(2-chloroethylamino)-1-oxopropan-2-yl]carbamate (PubChem CID 125470316) has the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. Its IUPAC name is benzyl N-[(2R)-1-(2-chloroethylamino)-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R)-1-(2-chloroethylamino)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 125470316 |
| Molecular Formula | C13H17ClN2O3 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | benzyl N-[(2R)-1-(2-chloroethylamino)-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@@H](NC(=O)OCc1ccccc1)C(=O)NCCCl |
| InChI | InChI=1S/C13H17ClN2O3/c1-10(12(17)15-8-7-14)16-13(18)19-9-11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3,(H,15,17)(H,16,18)/t10-/m1/s1 |
| InChIKey | GMWDFRVFEDQNFU-SNVBAGLBSA-N |
| XLogP | 1.66 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|