C13H18N2O5P+ — CID 57082591
hydroxy-oxo-[2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]ethyl]phosphanium (PubChem CID 57082591) has the molecular formula C13H18N2O5P+ and a molecular weight of 313.27 g/mol. Its IUPAC name is hydroxy-oxo-[2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]ethyl]phosphanium.
| Compound Name | hydroxy-oxo-[2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]ethyl]phosphanium |
|---|---|
| PubChem CID | 57082591 |
| Molecular Formula | C13H18N2O5P+ |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | hydroxy-oxo-[2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]ethyl]phosphanium |
| SMILES | C[C@H](NC(=O)OCc1ccccc1)C(=O)NCC[P+](=O)O |
| InChI | InChI=1S/C13H17N2O5P/c1-10(12(16)14-7-8-21(18)19)15-13(17)20-9-11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3,(H2-,14,15,16,17,18,19)/p+1/t10-/m0/s1 |
| InChIKey | ATKSDOLRMOYKBT-JTQLQIEISA-O |
| XLogP | 1.15 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|