C16H22N2O5 — CID 67664109
3-[2-(phenylmethoxycarbonylamino)propanoylamino]propyl acetate (PubChem CID 67664109) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is 3-[2-(phenylmethoxycarbonylamino)propanoylamino]propyl acetate.
| Compound Name | 3-[2-(phenylmethoxycarbonylamino)propanoylamino]propyl acetate |
|---|---|
| PubChem CID | 67664109 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 3-[2-(phenylmethoxycarbonylamino)propanoylamino]propyl acetate |
| SMILES | CC(=O)OCCCNC(=O)C(C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H22N2O5/c1-12(15(20)17-9-6-10-22-13(2)19)18-16(21)23-11-14-7-4-3-5-8-14/h3-5,7-8,12H,6,9-11H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | BSULAQFKCGJQFJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|