C25H29N3O8 — CID 22826710
benzyl (2S)-2-[[2-acetyloxy-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetyl]amino]propanoate (PubChem CID 22826710) has the molecular formula C25H29N3O8 and a molecular weight of 499.52 g/mol. Its IUPAC name is benzyl (2S)-2-[[2-acetyloxy-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetyl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[2-acetyloxy-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 22826710 |
| Molecular Formula | C25H29N3O8 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | benzyl (2S)-2-[[2-acetyloxy-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetyl]amino]propanoate |
| SMILES | CC(=O)OC(NC(=O)[C@H](C)NC(=O)OCc1ccccc1)C(=O)N[C@@H](C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H29N3O8/c1-16(27-25(33)35-15-20-12-8-5-9-13-20)21(30)28-23(36-18(3)29)22(31)26-17(2)24(32)34-14-19-10-6-4-7-11-19/h4-13,16-17,23H,14-15H2,1-3H3,(H,26,31)(H,27,33)(H,28,30)/t16-,17-,23?/m0/s1 |
| InChIKey | OYPGDYHRLFOWJI-UYHNVOLQSA-N |
| XLogP | 1.55 |
| TPSA | 149.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|