C22H24N2O7 — CID 14377778
benzyl 2-acetyloxy-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetate (PubChem CID 14377778) has the molecular formula C22H24N2O7 and a molecular weight of 428.44 g/mol. Its IUPAC name is benzyl 2-acetyloxy-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetate.
| Compound Name | benzyl 2-acetyloxy-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetate |
|---|---|
| PubChem CID | 14377778 |
| Molecular Formula | C22H24N2O7 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | benzyl 2-acetyloxy-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetate |
| SMILES | CC(=O)OC(NC(=O)[C@H](C)NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H24N2O7/c1-15(23-22(28)30-14-18-11-7-4-8-12-18)19(26)24-20(31-16(2)25)21(27)29-13-17-9-5-3-6-10-17/h3-12,15,20H,13-14H2,1-2H3,(H,23,28)(H,24,26)/t15-,20?/m0/s1 |
| InChIKey | GBOVXDQZNWBKRX-OOJLDXBWSA-N |
| XLogP | 2.05 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|