C11H15NO4P+ — CID 19090886
hydroxy-oxo-[3-(phenylmethoxycarbonylamino)propyl]phosphanium (PubChem CID 19090886) has the molecular formula C11H15NO4P+ and a molecular weight of 256.22 g/mol. Its IUPAC name is hydroxy-oxo-[3-(phenylmethoxycarbonylamino)propyl]phosphanium.
| Compound Name | hydroxy-oxo-[3-(phenylmethoxycarbonylamino)propyl]phosphanium |
|---|---|
| PubChem CID | 19090886 |
| Molecular Formula | C11H15NO4P+ |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | hydroxy-oxo-[3-(phenylmethoxycarbonylamino)propyl]phosphanium |
| SMILES | O=C(NCCC[P+](=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C11H14NO4P/c13-11(12-7-4-8-17(14)15)16-9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2,(H-,12,13,14,15)/p+1 |
| InChIKey | SBNZPJLMEUSAEK-UHFFFAOYSA-O |
| XLogP | 2.04 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|