C13H21ClN2O3 — CID 165436022
benzyl N-(5-aminooxypentyl)carbamate;hydrochloride (PubChem CID 165436022) has the molecular formula C13H21ClN2O3 and a molecular weight of 288.77 g/mol. Its IUPAC name is benzyl N-(5-aminooxypentyl)carbamate;hydrochloride.
| Compound Name | benzyl N-(5-aminooxypentyl)carbamate;hydrochloride |
|---|---|
| PubChem CID | 165436022 |
| Molecular Formula | C13H21ClN2O3 |
| Molecular Weight | 288.77 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | benzyl N-(5-aminooxypentyl)carbamate;hydrochloride |
| SMILES | Cl.NOCCCCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H20N2O3.ClH/c14-18-10-6-2-5-9-15-13(16)17-11-12-7-3-1-4-8-12;/h1,3-4,7-8H,2,5-6,9-11,14H2,(H,15,16);1H |
| InChIKey | MCZIZDQZLWRWTA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.77 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|