C14H18NNaO4 — CID 102088654
sodium 6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 102088654) has the molecular formula C14H18NNaO4 and a molecular weight of 287.29 g/mol. Its IUPAC name is sodium 6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | sodium 6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 102088654 |
| Molecular Formula | C14H18NNaO4 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | sodium 6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | O=C([O-])CCCCCNC(=O)OCc1ccccc1.[Na+] |
| InChI | InChI=1S/C14H19NO4.Na/c16-13(17)9-5-2-6-10-15-14(18)19-11-12-7-3-1-4-8-12;/h1,3-4,7-8H,2,5-6,9-11H2,(H,15,18)(H,16,17);/q;+1/p-1 |
| InChIKey | FEDUARXHJFIYQU-UHFFFAOYSA-M |
| XLogP | -1.77 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|