C21H34N2O4 — CID 59544023
benzyl N-[11-[methoxy(methyl)amino]-11-oxoundecyl]carbamate (PubChem CID 59544023) has the molecular formula C21H34N2O4 and a molecular weight of 378.51 g/mol. Its IUPAC name is benzyl N-[11-[methoxy(methyl)amino]-11-oxoundecyl]carbamate.
| Compound Name | benzyl N-[11-[methoxy(methyl)amino]-11-oxoundecyl]carbamate |
|---|---|
| PubChem CID | 59544023 |
| Molecular Formula | C21H34N2O4 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | benzyl N-[11-[methoxy(methyl)amino]-11-oxoundecyl]carbamate |
| SMILES | CON(C)C(=O)CCCCCCCCCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H34N2O4/c1-23(26-2)20(24)16-12-7-5-3-4-6-8-13-17-22-21(25)27-18-19-14-10-9-11-15-19/h9-11,14-15H,3-8,12-13,16-18H2,1-2H3,(H,22,25) |
| InChIKey | SJFVSLZGLWLWHS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|