C17H24N2O5 — CID 129041037
4-oxo-4-[5-(phenylmethoxycarbonylamino)pentylamino]butanoic acid (PubChem CID 129041037) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is 4-oxo-4-[5-(phenylmethoxycarbonylamino)pentylamino]butanoic acid.
| Compound Name | 4-oxo-4-[5-(phenylmethoxycarbonylamino)pentylamino]butanoic acid |
|---|---|
| PubChem CID | 129041037 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 4-oxo-4-[5-(phenylmethoxycarbonylamino)pentylamino]butanoic acid |
| SMILES | O=C(O)CCC(=O)NCCCCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H24N2O5/c20-15(9-10-16(21)22)18-11-5-2-6-12-19-17(23)24-13-14-7-3-1-4-8-14/h1,3-4,7-8H,2,5-6,9-13H2,(H,18,20)(H,19,23)(H,21,22) |
| InChIKey | ITFZNDTYCNWPEH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|