C14H20N2O6S — CID 45490396
2-[4-(phenylmethoxycarbonylamino)butanoylamino]ethanesulfonic acid (PubChem CID 45490396) has the molecular formula C14H20N2O6S and a molecular weight of 344.39 g/mol. Its IUPAC name is 2-[4-(phenylmethoxycarbonylamino)butanoylamino]ethanesulfonic acid.
| Compound Name | 2-[4-(phenylmethoxycarbonylamino)butanoylamino]ethanesulfonic acid |
|---|---|
| PubChem CID | 45490396 |
| Molecular Formula | C14H20N2O6S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 2-[4-(phenylmethoxycarbonylamino)butanoylamino]ethanesulfonic acid |
| SMILES | O=C(CCCNC(=O)OCc1ccccc1)NCCS(=O)(=O)O |
| InChI | InChI=1S/C14H20N2O6S/c17-13(15-9-10-23(19,20)21)7-4-8-16-14(18)22-11-12-5-2-1-3-6-12/h1-3,5-6H,4,7-11H2,(H,15,17)(H,16,18)(H,19,20,21) |
| InChIKey | MHBGQQITHGXHJJ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|