C20H31N3O5 — CID 155369198
6-[[2-amino-6-(phenylmethoxycarbonylamino)hexanoyl]amino]hexanoic acid (PubChem CID 155369198) has the molecular formula C20H31N3O5 and a molecular weight of 393.48 g/mol. Its IUPAC name is 6-[[2-amino-6-(phenylmethoxycarbonylamino)hexanoyl]amino]hexanoic acid.
| Compound Name | 6-[[2-amino-6-(phenylmethoxycarbonylamino)hexanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 155369198 |
| Molecular Formula | C20H31N3O5 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 6-[[2-amino-6-(phenylmethoxycarbonylamino)hexanoyl]amino]hexanoic acid |
| SMILES | NC(CCCCNC(=O)OCc1ccccc1)C(=O)NCCCCCC(=O)O |
| InChI | InChI=1S/C20H31N3O5/c21-17(19(26)22-13-7-2-5-12-18(24)25)11-6-8-14-23-20(27)28-15-16-9-3-1-4-10-16/h1,3-4,9-10,17H,2,5-8,11-15,21H2,(H,22,26)(H,23,27)(H,24,25) |
| InChIKey | HUPXWSWMNOZDCE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|