C48H62N6O9 — CID 126626918
benzyl N-[3-[[2-amino-6-(phenylmethoxycarbonylamino)hexanoyl]amino]propyl]-N-[4-[phenylmethoxycarbonyl-[3-(phenylmethoxycarbonylamino)propyl]amino]butyl]carbamate (PubChem CID 126626918) has the molecular formula C48H62N6O9 and a molecular weight of 867.06 g/mol. Its IUPAC name is benzyl N-[3-[[2-amino-6-(phenylmethoxycarbonylamino)hexanoyl]amino]propyl]-N-[4-[phenylmethoxycarbonyl-[3-(phenylmethoxycarbonylamino)propyl]amino]butyl]carbamate.
| Compound Name | benzyl N-[3-[[2-amino-6-(phenylmethoxycarbonylamino)hexanoyl]amino]propyl]-N-[4-[phenylmethoxycarbonyl-[3-(phenylmethoxycarbonylamino)propyl]amino]butyl]carbamate |
|---|---|
| PubChem CID | 126626918 |
| Molecular Formula | C48H62N6O9 |
| Molecular Weight | 867.06 g/mol |
| Exact Mass | 866.46 |
| IUPAC Name | benzyl N-[3-[[2-amino-6-(phenylmethoxycarbonylamino)hexanoyl]amino]propyl]-N-[4-[phenylmethoxycarbonyl-[3-(phenylmethoxycarbonylamino)propyl]amino]butyl]carbamate |
| SMILES | NC(CCCCNC(=O)OCc1ccccc1)C(=O)NCCCN(CCCCN(CCCNC(=O)OCc1ccccc1)C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C48H62N6O9/c49-43(27-13-14-28-51-45(56)60-35-39-19-5-1-6-20-39)44(55)50-29-17-33-53(47(58)62-37-41-23-9-3-10-24-41)31-15-16-32-54(48(59)63-38-42-25-11-4-12-26-42)34-18-30-52-46(57)61-36-40-21-7-2-8-22-40/h1-12,19-26,43H,13-18,27-38,49H2,(H,50,55)(H,51,56)(H,52,57) |
| InChIKey | OGYAEPHXOBYHJL-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 190.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.06 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|