C18H28N2O4 — CID 154988305
2-methylpropyl (2S)-2-amino-6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 154988305) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is 2-methylpropyl (2S)-2-amino-6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | 2-methylpropyl (2S)-2-amino-6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 154988305 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 2-methylpropyl (2S)-2-amino-6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | CC(C)COC(=O)[C@@H](N)CCCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H28N2O4/c1-14(2)12-23-17(21)16(19)10-6-7-11-20-18(22)24-13-15-8-4-3-5-9-15/h3-5,8-9,14,16H,6-7,10-13,19H2,1-2H3,(H,20,22)/t16-/m0/s1 |
| InChIKey | DRQPELWHACPBJF-INIZCTEOSA-N |
| XLogP | 2.61 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|