C22H26N2O5 — CID 70089794
phenacyl (2S)-2-amino-6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 70089794) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is phenacyl (2S)-2-amino-6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | phenacyl (2S)-2-amino-6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 70089794 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | phenacyl (2S)-2-amino-6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | N[C@@H](CCCCNC(=O)OCc1ccccc1)C(=O)OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H26N2O5/c23-19(21(26)28-16-20(25)18-11-5-2-6-12-18)13-7-8-14-24-22(27)29-15-17-9-3-1-4-10-17/h1-6,9-12,19H,7-8,13-16,23H2,(H,24,27)/t19-/m0/s1 |
| InChIKey | JEXKINACIZNKOE-IBGZPJMESA-N |
| XLogP | 2.84 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|