C19H32N2O4Si — CID 20626808
2-trimethylsilylethyl 2-amino-6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 20626808) has the molecular formula C19H32N2O4Si and a molecular weight of 380.56 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-amino-6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | 2-trimethylsilylethyl 2-amino-6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 20626808 |
| Molecular Formula | C19H32N2O4Si |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 2-trimethylsilylethyl 2-amino-6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | C[Si](C)(C)CCOC(=O)C(N)CCCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H32N2O4Si/c1-26(2,3)14-13-24-18(22)17(20)11-7-8-12-21-19(23)25-15-16-9-5-4-6-10-16/h4-6,9-10,17H,7-8,11-15,20H2,1-3H3,(H,21,23) |
| InChIKey | KXAYBQDUNABEJR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|