C24H32ClN3O5 — CID 70414486
benzyl (2R)-2-[[(2S)-2-amino-6-(phenylmethoxycarbonylamino)hexanoyl]amino]propanoate;hydrochloride (PubChem CID 70414486) has the molecular formula C24H32ClN3O5 and a molecular weight of 477.99 g/mol. Its IUPAC name is benzyl (2R)-2-[[(2S)-2-amino-6-(phenylmethoxycarbonylamino)hexanoyl]amino]propanoate;hydrochloride.
| Compound Name | benzyl (2R)-2-[[(2S)-2-amino-6-(phenylmethoxycarbonylamino)hexanoyl]amino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 70414486 |
| Molecular Formula | C24H32ClN3O5 |
| Molecular Weight | 477.99 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | benzyl (2R)-2-[[(2S)-2-amino-6-(phenylmethoxycarbonylamino)hexanoyl]amino]propanoate;hydrochloride |
| SMILES | C[C@@H](NC(=O)[C@@H](N)CCCCNC(=O)OCc1ccccc1)C(=O)OCc1ccccc1.Cl |
| InChI | InChI=1S/C24H31N3O5.ClH/c1-18(23(29)31-16-19-10-4-2-5-11-19)27-22(28)21(25)14-8-9-15-26-24(30)32-17-20-12-6-3-7-13-20;/h2-7,10-13,18,21H,8-9,14-17,25H2,1H3,(H,26,30)(H,27,28);1H/t18-,21+;/m1./s1 |
| InChIKey | QOGZNNRNAWPABY-WKOQGQMTSA-N |
| XLogP | 3.08 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.99 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|