C21H33N7O6 — CID 131711196
benzyl N-[(5S)-5-amino-6-[[(2S)-4-amino-1-[[(2S)-1-hydrazinyl-1-oxopropan-2-yl]amino]-1,4-dioxobutan-2-yl]amino]-6-oxohexyl]carbamate (PubChem CID 131711196) has the molecular formula C21H33N7O6 and a molecular weight of 479.54 g/mol. Its IUPAC name is benzyl N-[(5S)-5-amino-6-[[(2S)-4-amino-1-[[(2S)-1-hydrazinyl-1-oxopropan-2-yl]amino]-1,4-dioxobutan-2-yl]amino]-6-oxohexyl]carbamate.
| Compound Name | benzyl N-[(5S)-5-amino-6-[[(2S)-4-amino-1-[[(2S)-1-hydrazinyl-1-oxopropan-2-yl]amino]-1,4-dioxobutan-2-yl]amino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 131711196 |
| Molecular Formula | C21H33N7O6 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | benzyl N-[(5S)-5-amino-6-[[(2S)-4-amino-1-[[(2S)-1-hydrazinyl-1-oxopropan-2-yl]amino]-1,4-dioxobutan-2-yl]amino]-6-oxohexyl]carbamate |
| SMILES | C[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](N)CCCCNC(=O)OCc1ccccc1)C(=O)NN |
| InChI | InChI=1S/C21H33N7O6/c1-13(18(30)28-24)26-20(32)16(11-17(23)29)27-19(31)15(22)9-5-6-10-25-21(33)34-12-14-7-3-2-4-8-14/h2-4,7-8,13,15-16H,5-6,9-12,22,24H2,1H3,(H2,23,29)(H,25,33)(H,26,32)(H,27,31)(H,28,30)/t13-,15-,16-/m0/s1 |
| InChIKey | YSXOBOSESUMPGD-BPUTZDHNSA-N |
| XLogP | -1.73 |
| TPSA | 220.76 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|