C40H40N2O10 — CID 15383000
diphenacyl (2S,7S)-2,7-bis(phenylmethoxycarbonylamino)octanedioate (PubChem CID 15383000) has the molecular formula C40H40N2O10 and a molecular weight of 708.76 g/mol. Its IUPAC name is diphenacyl (2S,7S)-2,7-bis(phenylmethoxycarbonylamino)octanedioate.
| Compound Name | diphenacyl (2S,7S)-2,7-bis(phenylmethoxycarbonylamino)octanedioate |
|---|---|
| PubChem CID | 15383000 |
| Molecular Formula | C40H40N2O10 |
| Molecular Weight | 708.76 g/mol |
| Exact Mass | 708.27 |
| IUPAC Name | diphenacyl (2S,7S)-2,7-bis(phenylmethoxycarbonylamino)octanedioate |
| SMILES | O=C(N[C@@H](CCCC[C@H](NC(=O)OCc1ccccc1)C(=O)OCC(=O)c1ccccc1)C(=O)OCC(=O)c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C40H40N2O10/c43-35(31-19-9-3-10-20-31)27-49-37(45)33(41-39(47)51-25-29-15-5-1-6-16-29)23-13-14-24-34(42-40(48)52-26-30-17-7-2-8-18-30)38(46)50-28-36(44)32-21-11-4-12-22-32/h1-12,15-22,33-34H,13-14,23-28H2,(H,41,47)(H,42,48)/t33-,34-/m0/s1 |
| InChIKey | TZHQMOZUVTWXKO-HEVIKAOCSA-N |
| XLogP | 5.99 |
| TPSA | 163.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.76 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|