C15H20ClNO4 — CID 171393372
chloromethyl (2S)-2-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 171393372) has the molecular formula C15H20ClNO4 and a molecular weight of 313.78 g/mol. Its IUPAC name is chloromethyl (2S)-2-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | chloromethyl (2S)-2-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 171393372 |
| Molecular Formula | C15H20ClNO4 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | chloromethyl (2S)-2-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | CCCC[C@H](NC(=O)OCc1ccccc1)C(=O)OCCl |
| InChI | InChI=1S/C15H20ClNO4/c1-2-3-9-13(14(18)21-11-16)17-15(19)20-10-12-7-5-4-6-8-12/h4-8,13H,2-3,9-11H2,1H3,(H,17,19)/t13-/m0/s1 |
| InChIKey | AORKRNYPAOTDBE-ZDUSSCGKSA-N |
| XLogP | 3.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|