C17H22F3NO4 — CID 102186503
2,2,2-trifluoroethyl (2S)-2-(phenylmethoxycarbonylamino)heptanoate (PubChem CID 102186503) has the molecular formula C17H22F3NO4 and a molecular weight of 361.36 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl (2S)-2-(phenylmethoxycarbonylamino)heptanoate.
| Compound Name | 2,2,2-trifluoroethyl (2S)-2-(phenylmethoxycarbonylamino)heptanoate |
|---|---|
| PubChem CID | 102186503 |
| Molecular Formula | C17H22F3NO4 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 2,2,2-trifluoroethyl (2S)-2-(phenylmethoxycarbonylamino)heptanoate |
| SMILES | CCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C17H22F3NO4/c1-2-3-5-10-14(15(22)25-12-17(18,19)20)21-16(23)24-11-13-8-6-4-7-9-13/h4,6-9,14H,2-3,5,10-12H2,1H3,(H,21,23)/t14-/m0/s1 |
| InChIKey | WJKZRJHJMQTZTN-AWEZNQCLSA-N |
| XLogP | 3.97 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|