C18H22F6N2O4 — CID 100914510
2,2,2-trifluoroethyl (2S)-2-(phenylmethoxycarbonylamino)-6-(2,2,2-trifluoroethylamino)hexanoate (PubChem CID 100914510) has the molecular formula C18H22F6N2O4 and a molecular weight of 444.37 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl (2S)-2-(phenylmethoxycarbonylamino)-6-(2,2,2-trifluoroethylamino)hexanoate.
| Compound Name | 2,2,2-trifluoroethyl (2S)-2-(phenylmethoxycarbonylamino)-6-(2,2,2-trifluoroethylamino)hexanoate |
|---|---|
| PubChem CID | 100914510 |
| Molecular Formula | C18H22F6N2O4 |
| Molecular Weight | 444.37 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 2,2,2-trifluoroethyl (2S)-2-(phenylmethoxycarbonylamino)-6-(2,2,2-trifluoroethylamino)hexanoate |
| SMILES | O=C(N[C@@H](CCCCNCC(F)(F)F)C(=O)OCC(F)(F)F)OCc1ccccc1 |
| InChI | InChI=1S/C18H22F6N2O4/c19-17(20,21)11-25-9-5-4-8-14(15(27)30-12-18(22,23)24)26-16(28)29-10-13-6-2-1-3-7-13/h1-3,6-7,14,25H,4-5,8-12H2,(H,26,28)/t14-/m0/s1 |
| InChIKey | CCQSCNJAILWJIU-AWEZNQCLSA-N |
| XLogP | 3.71 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|