C24H30N2O7 — CID 166903583
2-hydroxyethyl (2S)-2,6-bis(phenylmethoxycarbonylamino)hexanoate (PubChem CID 166903583) has the molecular formula C24H30N2O7 and a molecular weight of 458.51 g/mol. Its IUPAC name is 2-hydroxyethyl (2S)-2,6-bis(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | 2-hydroxyethyl (2S)-2,6-bis(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 166903583 |
| Molecular Formula | C24H30N2O7 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 2-hydroxyethyl (2S)-2,6-bis(phenylmethoxycarbonylamino)hexanoate |
| SMILES | O=C(NCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)OCCO)OCc1ccccc1 |
| InChI | InChI=1S/C24H30N2O7/c27-15-16-31-22(28)21(26-24(30)33-18-20-11-5-2-6-12-20)13-7-8-14-25-23(29)32-17-19-9-3-1-4-10-19/h1-6,9-12,21,27H,7-8,13-18H2,(H,25,29)(H,26,30)/t21-/m0/s1 |
| InChIKey | RJVYMXPGAYGHGL-NRFANRHFSA-N |
| XLogP | 2.91 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|