C25H31N3O7 — CID 166903633
2-[[(2R)-2,6-bis(phenylmethoxycarbonylamino)hexanoyl]-methylamino]acetic acid (PubChem CID 166903633) has the molecular formula C25H31N3O7 and a molecular weight of 485.54 g/mol. Its IUPAC name is 2-[[(2R)-2,6-bis(phenylmethoxycarbonylamino)hexanoyl]-methylamino]acetic acid.
| Compound Name | 2-[[(2R)-2,6-bis(phenylmethoxycarbonylamino)hexanoyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 166903633 |
| Molecular Formula | C25H31N3O7 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 2-[[(2R)-2,6-bis(phenylmethoxycarbonylamino)hexanoyl]-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)C(=O)[C@@H](CCCCNC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H31N3O7/c1-28(16-22(29)30)23(31)21(27-25(33)35-18-20-12-6-3-7-13-20)14-8-9-15-26-24(32)34-17-19-10-4-2-5-11-19/h2-7,10-13,21H,8-9,14-18H2,1H3,(H,26,32)(H,27,33)(H,29,30)/t21-/m1/s1 |
| InChIKey | VSTHVPWEEUADML-OAQYLSRUSA-N |
| XLogP | 2.92 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|