C23H28N2O6 — CID 11418942
(3S)-3,7-bis(phenylmethoxycarbonylamino)heptanoic acid (PubChem CID 11418942) has the molecular formula C23H28N2O6 and a molecular weight of 428.49 g/mol. Its IUPAC name is (3S)-3,7-bis(phenylmethoxycarbonylamino)heptanoic acid.
| Compound Name | (3S)-3,7-bis(phenylmethoxycarbonylamino)heptanoic acid |
|---|---|
| PubChem CID | 11418942 |
| Molecular Formula | C23H28N2O6 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | (3S)-3,7-bis(phenylmethoxycarbonylamino)heptanoic acid |
| SMILES | O=C(O)C[C@H](CCCCNC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H28N2O6/c26-21(27)15-20(25-23(29)31-17-19-11-5-2-6-12-19)13-7-8-14-24-22(28)30-16-18-9-3-1-4-10-18/h1-6,9-12,20H,7-8,13-17H2,(H,24,28)(H,25,29)(H,26,27)/t20-/m0/s1 |
| InChIKey | RPXXCGBSEMSKNB-FQEVSTJZSA-N |
| XLogP | 3.85 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|