(3S)-3,7-bis(phenylmethoxycarbonylamino)heptanoic acid

C23H28N2O6 — CID 11418942

IUPAC(3S)-3,7-bis(phenylmethoxycarbonylamino)heptanoic acid
SMILESO=C(O)C[C@H](CCCCNC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1
InChIInChI=1S/C23H28N2O6/c26-21(27)15-20(25-23(29)31-17-19-11-5-2-6-12-19)13-7-8-14-24-22(28)30-16-18-9-3-1-4-10-18/h1-6,9-12,20H,7-8,13-17H2,(H,24,28)(H,25,29)(H,26,27)/t20-/m0/s1
InChIKeyRPXXCGBSEMSKNB-FQEVSTJZSA-N
MW428.49 g/mol
LogP3.85
Rot. Bonds12

About (3S)-3,7-bis(phenylmethoxycarbonylamino)heptanoic acid

(3S)-3,7-bis(phenylmethoxycarbonylamino)heptanoic acid (PubChem CID 11418942) has the molecular formula C23H28N2O6 and a molecular weight of 428.49 g/mol. Its IUPAC name is (3S)-3,7-bis(phenylmethoxycarbonylamino)heptanoic acid.

Molecular Properties

Compound Name(3S)-3,7-bis(phenylmethoxycarbonylamino)heptanoic acid
PubChem CID11418942
Molecular FormulaC23H28N2O6
Molecular Weight428.49 g/mol
Exact Mass428.19
IUPAC Name(3S)-3,7-bis(phenylmethoxycarbonylamino)heptanoic acid
SMILESO=C(O)C[C@H](CCCCNC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1
InChIInChI=1S/C23H28N2O6/c26-21(27)15-20(25-23(29)31-17-19-11-5-2-6-12-19)13-7-8-14-24-22(28)30-16-18-9-3-1-4-10-18/h1-6,9-12,20H,7-8,13-17H2,(H,24,28)(H,25,29)(H,26,27)/t20-/m0/s1
InChIKeyRPXXCGBSEMSKNB-FQEVSTJZSA-N
XLogP3.85
TPSA113.96 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds12
Heavy Atoms31
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500428.49
LogP ≤ 53.85
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze (3S)-3,7-bis(phenylmethoxycarbonylamino)heptanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3S)-3,7-bis(phenylmethoxycarbonylamino)heptanoic acid?
The IUPAC name of (3S)-3,7-bis(phenylmethoxycarbonylamino)heptanoic acid (CID 11418942) is (3S)-3,7-bis(phenylmethoxycarbonylamino)heptanoic acid.
What is the SMILES notation for (3S)-3,7-bis(phenylmethoxycarbonylamino)heptanoic acid?
The canonical SMILES for (3S)-3,7-bis(phenylmethoxycarbonylamino)heptanoic acid is O=C(O)C[C@H](CCCCNC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1.
What is the InChIKey of (3S)-3,7-bis(phenylmethoxycarbonylamino)heptanoic acid?
The InChIKey is RPXXCGBSEMSKNB-FQEVSTJZSA-N. The full InChI is InChI=1S/C23H28N2O6/c26-21(27)15-20(25-23(29)31-17-19-11-5-2-6-12-19)13-7-8-14-24-22(28)30-16-18-9-3-1-4-10-18/h1-6,9-12,20H,7-8,13-17H2,(H,24,28)(H,25,29)(H,26,27)/t20-/m0/s1.
What are the key properties of (3S)-3,7-bis(phenylmethoxycarbonylamino)heptanoic acid?
(3S)-3,7-bis(phenylmethoxycarbonylamino)heptanoic acid has a molecular weight of 428.49 g/mol, XLogP of 3.85, 12 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3,7-bis(phenylmethoxycarbonylamino)heptanoic acid is sourced from PubChem (CID 11418942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).