C19H29IN2O4 — CID 135063763
benzyl N-[(2S)-1-iodo-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-2-yl]carbamate (PubChem CID 135063763) has the molecular formula C19H29IN2O4 and a molecular weight of 476.36 g/mol. Its IUPAC name is benzyl N-[(2S)-1-iodo-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-iodo-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 135063763 |
| Molecular Formula | C19H29IN2O4 |
| Molecular Weight | 476.36 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | benzyl N-[(2S)-1-iodo-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@@H](CI)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H29IN2O4/c1-19(2,3)26-17(23)21-12-8-7-11-16(13-20)22-18(24)25-14-15-9-5-4-6-10-15/h4-6,9-10,16H,7-8,11-14H2,1-3H3,(H,21,23)(H,22,24)/t16-/m0/s1 |
| InChIKey | UEMJVCATJHNMOG-INIZCTEOSA-N |
| XLogP | 4.41 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|