C40H57N5O8 — CID 144943449
benzyl N-[1-[bis[2-(phenylmethoxycarbonylamino)ethyl]amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-2-yl]carbamate;ethane (PubChem CID 144943449) has the molecular formula C40H57N5O8 and a molecular weight of 735.92 g/mol. Its IUPAC name is benzyl N-[1-[bis[2-(phenylmethoxycarbonylamino)ethyl]amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-2-yl]carbamate;ethane.
| Compound Name | benzyl N-[1-[bis[2-(phenylmethoxycarbonylamino)ethyl]amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-2-yl]carbamate;ethane |
|---|---|
| PubChem CID | 144943449 |
| Molecular Formula | C40H57N5O8 |
| Molecular Weight | 735.92 g/mol |
| Exact Mass | 735.42 |
| IUPAC Name | benzyl N-[1-[bis[2-(phenylmethoxycarbonylamino)ethyl]amino]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-2-yl]carbamate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)NCCCC(CN(CCNC(=O)OCc1ccccc1)CCNC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C38H51N5O8.C2H6/c1-38(2,3)51-36(46)39-21-13-20-33(42-37(47)50-29-32-18-11-6-12-19-32)26-43(24-22-40-34(44)48-27-30-14-7-4-8-15-30)25-23-41-35(45)49-28-31-16-9-5-10-17-31;1-2/h4-12,14-19,33H,13,20-29H2,1-3H3,(H,39,46)(H,40,44)(H,41,45)(H,42,47);1-2H3 |
| InChIKey | ZVYRFXFPSCQBDM-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 156.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.92 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|