C27H44N4O6 — CID 161017499
benzyl 4-[2-acetamidoethyl-[2-acetamido-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]amino]butanoate (PubChem CID 161017499) has the molecular formula C27H44N4O6 and a molecular weight of 520.67 g/mol. Its IUPAC name is benzyl 4-[2-acetamidoethyl-[2-acetamido-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]amino]butanoate.
| Compound Name | benzyl 4-[2-acetamidoethyl-[2-acetamido-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]amino]butanoate |
|---|---|
| PubChem CID | 161017499 |
| Molecular Formula | C27H44N4O6 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.33 |
| IUPAC Name | benzyl 4-[2-acetamidoethyl-[2-acetamido-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]amino]butanoate |
| SMILES | CC(=O)NCCN(CCCC(=O)OCc1ccccc1)CC(CCCNC(=O)OC(C)(C)C)NC(C)=O |
| InChI | InChI=1S/C27H44N4O6/c1-21(32)28-16-18-31(17-10-14-25(34)36-20-23-11-7-6-8-12-23)19-24(30-22(2)33)13-9-15-29-26(35)37-27(3,4)5/h6-8,11-12,24H,9-10,13-20H2,1-5H3,(H,28,32)(H,29,35)(H,30,33) |
| InChIKey | HYAYPZQZCGUNFB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|