C38H58N2O8 — CID 171814491
benzyl 7-hydroxy-8-[(2-hydroxy-8-oxo-8-phenylmethoxyoctyl)-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]octanoate (PubChem CID 171814491) has the molecular formula C38H58N2O8 and a molecular weight of 670.89 g/mol. Its IUPAC name is benzyl 7-hydroxy-8-[(2-hydroxy-8-oxo-8-phenylmethoxyoctyl)-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]octanoate.
| Compound Name | benzyl 7-hydroxy-8-[(2-hydroxy-8-oxo-8-phenylmethoxyoctyl)-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]octanoate |
|---|---|
| PubChem CID | 171814491 |
| Molecular Formula | C38H58N2O8 |
| Molecular Weight | 670.89 g/mol |
| Exact Mass | 670.42 |
| IUPAC Name | benzyl 7-hydroxy-8-[(2-hydroxy-8-oxo-8-phenylmethoxyoctyl)-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]octanoate |
| SMILES | CC(C)(C)OC(=O)NCCCN(CC(O)CCCCCC(=O)OCc1ccccc1)CC(O)CCCCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C38H58N2O8/c1-38(2,3)48-37(45)39-25-16-26-40(27-33(41)21-12-6-14-23-35(43)46-29-31-17-8-4-9-18-31)28-34(42)22-13-7-15-24-36(44)47-30-32-19-10-5-11-20-32/h4-5,8-11,17-20,33-34,41-42H,6-7,12-16,21-30H2,1-3H3,(H,39,45) |
| InChIKey | AQWSKIGWWZYAKB-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.89 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|