C21H32F3N3O4 — CID 156823818
benzyl N-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl-(2,2,2-trifluoroethyl)amino]propyl]carbamate (PubChem CID 156823818) has the molecular formula C21H32F3N3O4 and a molecular weight of 447.50 g/mol. Its IUPAC name is benzyl N-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl-(2,2,2-trifluoroethyl)amino]propyl]carbamate.
| Compound Name | benzyl N-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl-(2,2,2-trifluoroethyl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 156823818 |
| Molecular Formula | C21H32F3N3O4 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | benzyl N-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl-(2,2,2-trifluoroethyl)amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCN(CCCNC(=O)OCc1ccccc1)CC(F)(F)F |
| InChI | InChI=1S/C21H32F3N3O4/c1-20(2,3)31-19(29)26-12-8-14-27(16-21(22,23)24)13-7-11-25-18(28)30-15-17-9-5-4-6-10-17/h4-6,9-10H,7-8,11-16H2,1-3H3,(H,25,28)(H,26,29) |
| InChIKey | MFOMEVKKTVXTRC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|