C25H33N3O6 — CID 90156380
benzyl N-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-N-[2-(phenylmethoxycarbonylamino)ethyl]carbamate (PubChem CID 90156380) has the molecular formula C25H33N3O6 and a molecular weight of 471.55 g/mol. Its IUPAC name is benzyl N-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-N-[2-(phenylmethoxycarbonylamino)ethyl]carbamate.
| Compound Name | benzyl N-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-N-[2-(phenylmethoxycarbonylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 90156380 |
| Molecular Formula | C25H33N3O6 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | benzyl N-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-N-[2-(phenylmethoxycarbonylamino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCN(CCNC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H33N3O6/c1-25(2,3)34-23(30)27-15-17-28(24(31)33-19-21-12-8-5-9-13-21)16-14-26-22(29)32-18-20-10-6-4-7-11-20/h4-13H,14-19H2,1-3H3,(H,26,29)(H,27,30) |
| InChIKey | JKPQKPQRGKABNC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|