C25H42N4O6 — CID 171775368
benzyl N-[3-[bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]propyl]carbamate (PubChem CID 171775368) has the molecular formula C25H42N4O6 and a molecular weight of 494.63 g/mol. Its IUPAC name is benzyl N-[3-[bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]propyl]carbamate.
| Compound Name | benzyl N-[3-[bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 171775368 |
| Molecular Formula | C25H42N4O6 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | benzyl N-[3-[bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCN(CCCNC(=O)OCc1ccccc1)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H42N4O6/c1-24(2,3)34-22(31)27-14-17-29(18-15-28-23(32)35-25(4,5)6)16-10-13-26-21(30)33-19-20-11-8-7-9-12-20/h7-9,11-12H,10,13-19H2,1-6H3,(H,26,30)(H,27,31)(H,28,32) |
| InChIKey | CGCGLZAZHFMMFA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|