C18H28N4O2 — CID 163963342
cyclodecapentaenylmethyl N-[2-[bis(2-aminoethyl)amino]ethyl]carbamate (PubChem CID 163963342) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is cyclodecapentaenylmethyl N-[2-[bis(2-aminoethyl)amino]ethyl]carbamate.
| Compound Name | cyclodecapentaenylmethyl N-[2-[bis(2-aminoethyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 163963342 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | cyclodecapentaenylmethyl N-[2-[bis(2-aminoethyl)amino]ethyl]carbamate |
| SMILES | NCCN(CCN)CCNC(=O)OCc1ccccccccc1 |
| InChI | InChI=1S/C18H28N4O2/c19-10-13-22(14-11-20)15-12-21-18(23)24-16-17-8-6-4-2-1-3-5-7-9-17/h1-9H,10-16,19-20H2,(H,21,23)/b2-1-,3-1-,4-2-,5-3+,6-4+,7-5+,8-6+,9-7-,17-8+,17-9+ |
| InChIKey | SJLJADKIPAWRDK-MDONJTKSSA-N |
| XLogP | 1.26 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |