C26H43N3O6 — CID 59367172
benzyl 5-[bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]pentanoate (PubChem CID 59367172) has the molecular formula C26H43N3O6 and a molecular weight of 493.65 g/mol. Its IUPAC name is benzyl 5-[bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]pentanoate.
| Compound Name | benzyl 5-[bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]pentanoate |
|---|---|
| PubChem CID | 59367172 |
| Molecular Formula | C26H43N3O6 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.32 |
| IUPAC Name | benzyl 5-[bis[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]pentanoate |
| SMILES | CC(C)(C)OC(=O)NCCN(CCCCC(=O)OCc1ccccc1)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H43N3O6/c1-25(2,3)34-23(31)27-15-18-29(19-16-28-24(32)35-26(4,5)6)17-11-10-14-22(30)33-20-21-12-8-7-9-13-21/h7-9,12-13H,10-11,14-20H2,1-6H3,(H,27,31)(H,28,32) |
| InChIKey | TXQHKLCHUQQSHB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|