C19H30N2O4 — CID 169156870
benzyl 4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]butanoate (PubChem CID 169156870) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is benzyl 4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]butanoate.
| Compound Name | benzyl 4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]butanoate |
|---|---|
| PubChem CID | 169156870 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | benzyl 4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylamino]butanoate |
| SMILES | CC(C)(C)OC(=O)NCCCNCCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H30N2O4/c1-19(2,3)25-18(23)21-14-8-13-20-12-7-11-17(22)24-15-16-9-5-4-6-10-16/h4-6,9-10,20H,7-8,11-15H2,1-3H3,(H,21,23) |
| InChIKey | SQKNIHLMDUPQGK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|