C19H33N3O2 — CID 130163649
tert-butyl N-[3-[3-[benzyl(methyl)amino]propylamino]propyl]carbamate (PubChem CID 130163649) has the molecular formula C19H33N3O2 and a molecular weight of 335.49 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[benzyl(methyl)amino]propylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-[benzyl(methyl)amino]propylamino]propyl]carbamate |
|---|---|
| PubChem CID | 130163649 |
| Molecular Formula | C19H33N3O2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | tert-butyl N-[3-[3-[benzyl(methyl)amino]propylamino]propyl]carbamate |
| SMILES | CN(CCCNCCCNC(=O)OC(C)(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C19H33N3O2/c1-19(2,3)24-18(23)21-14-8-12-20-13-9-15-22(4)16-17-10-6-5-7-11-17/h5-7,10-11,20H,8-9,12-16H2,1-4H3,(H,21,23) |
| InChIKey | TWPKWYJQRKWQPW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|