C13H17F3N2O — CID 62490939
N-[3-[benzyl(methyl)amino]propyl]-2,2,2-trifluoroacetamide (PubChem CID 62490939) has the molecular formula C13H17F3N2O and a molecular weight of 274.29 g/mol. Its IUPAC name is N-[3-[benzyl(methyl)amino]propyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[benzyl(methyl)amino]propyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 62490939 |
| Molecular Formula | C13H17F3N2O |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-[3-[benzyl(methyl)amino]propyl]-2,2,2-trifluoroacetamide |
| SMILES | CN(CCCNC(=O)C(F)(F)F)Cc1ccccc1 |
| InChI | InChI=1S/C13H17F3N2O/c1-18(10-11-6-3-2-4-7-11)9-5-8-17-12(19)13(14,15)16/h2-4,6-7H,5,8-10H2,1H3,(H,17,19) |
| InChIKey | YDOSRJMZODLYQJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|